C15H20ClF3N2O4S — CID 78874093
N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 78874093) has the molecular formula C15H20ClF3N2O4S and a molecular weight of 416.85 g/mol. Its IUPAC name is N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 78874093 |
| Molecular Formula | C15H20ClF3N2O4S |
| Molecular Weight | 416.85 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(NC(=O)C(C)OCC(F)(F)F)c1 |
| InChI | InChI=1S/C15H20ClF3N2O4S/c1-4-21(5-2)26(23,24)11-6-7-12(16)13(8-11)20-14(22)10(3)25-9-15(17,18)19/h6-8,10H,4-5,9H2,1-3H3,(H,20,22) |
| InChIKey | BBRBBSUYAKLMTA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |