C20H22ClN3O7S — CID 2505822
[(2S)-1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)benzoate (PubChem CID 2505822) has the molecular formula C20H22ClN3O7S and a molecular weight of 483.93 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2505822 |
| Molecular Formula | C20H22ClN3O7S |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | [(2S)-1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)O[C@@H](C)C(=O)Nc2cc([N+](=O)[O-])ccc2Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O7S/c1-4-23(5-2)32(29,30)16-8-6-7-14(11-16)20(26)31-13(3)19(25)22-18-12-15(24(27)28)9-10-17(18)21/h6-13H,4-5H2,1-3H3,(H,22,25)/t13-/m0/s1 |
| InChIKey | AEWYEQVZUKRYEO-ZDUSSCGKSA-N |
| XLogP | 3.46 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|