C16H13ClN2O6 — CID 18075891
[1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-hydroxybenzoate (PubChem CID 18075891) has the molecular formula C16H13ClN2O6 and a molecular weight of 364.74 g/mol. Its IUPAC name is [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-hydroxybenzoate.
| Compound Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-hydroxybenzoate |
|---|---|
| PubChem CID | 18075891 |
| Molecular Formula | C16H13ClN2O6 |
| Molecular Weight | 364.74 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-hydroxybenzoate |
| SMILES | CC(OC(=O)c1cccc(O)c1)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C16H13ClN2O6/c1-9(25-16(22)10-3-2-4-12(20)7-10)15(21)18-14-8-11(19(23)24)5-6-13(14)17/h2-9,20H,1H3,(H,18,21) |
| InChIKey | FEPRLZUVCQTOPI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.74 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|