C20H15ClN2O6 — CID 55318526
[1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-hydroxynaphthalene-2-carboxylate (PubChem CID 55318526) has the molecular formula C20H15ClN2O6 and a molecular weight of 414.80 g/mol. Its IUPAC name is [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-hydroxynaphthalene-2-carboxylate.
| Compound Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 55318526 |
| Molecular Formula | C20H15ClN2O6 |
| Molecular Weight | 414.80 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-hydroxynaphthalene-2-carboxylate |
| SMILES | CC(OC(=O)c1cc2ccccc2cc1O)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C20H15ClN2O6/c1-11(19(25)22-17-10-14(23(27)28)6-7-16(17)21)29-20(26)15-8-12-4-2-3-5-13(12)9-18(15)24/h2-11,24H,1H3,(H,22,25) |
| InChIKey | HXDQGDAVTLANHU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.80 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|