C16H12Cl2N2O6 — CID 9102688
[(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 5-chloro-2-hydroxybenzoate (PubChem CID 9102688) has the molecular formula C16H12Cl2N2O6 and a molecular weight of 399.19 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 5-chloro-2-hydroxybenzoate.
| Compound Name | [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 5-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 9102688 |
| Molecular Formula | C16H12Cl2N2O6 |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 5-chloro-2-hydroxybenzoate |
| SMILES | C[C@H](OC(=O)c1cc(Cl)ccc1O)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C16H12Cl2N2O6/c1-8(26-16(23)11-6-9(17)2-5-14(11)21)15(22)19-13-4-3-10(20(24)25)7-12(13)18/h2-8,21H,1H3,(H,19,22)/t8-/m0/s1 |
| InChIKey | JKOWBKWFHYIQAO-QMMMGPOBSA-N |
| XLogP | 3.79 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|