C18H17Cl2N3O6 — CID 40834876
[(2R)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)-5-nitrobenzoate (PubChem CID 40834876) has the molecular formula C18H17Cl2N3O6 and a molecular weight of 442.26 g/mol. Its IUPAC name is [(2R)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)-5-nitrobenzoate.
| Compound Name | [(2R)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 40834876 |
| Molecular Formula | C18H17Cl2N3O6 |
| Molecular Weight | 442.26 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | [(2R)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
| SMILES | C[C@@H](OC(=O)c1cc([N+](=O)[O-])ccc1NCCO)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2N3O6/c1-10(17(25)22-16-4-2-11(19)8-14(16)20)29-18(26)13-9-12(23(27)28)3-5-15(13)21-6-7-24/h2-5,8-10,21,24H,6-7H2,1H3,(H,22,25)/t10-/m1/s1 |
| InChIKey | FOVBARYGHGOEMX-SNVBAGLBSA-N |
| XLogP | 3.49 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|