C14H18N4O7 — CID 42970916
[1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)-5-nitrobenzoate (PubChem CID 42970916) has the molecular formula C14H18N4O7 and a molecular weight of 354.32 g/mol. Its IUPAC name is [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)-5-nitrobenzoate.
| Compound Name | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 42970916 |
| Molecular Formula | C14H18N4O7 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
| SMILES | CNC(=O)NC(=O)C(C)OC(=O)c1cc([N+](=O)[O-])ccc1NCCO |
| InChI | InChI=1S/C14H18N4O7/c1-8(12(20)17-14(22)15-2)25-13(21)10-7-9(18(23)24)3-4-11(10)16-5-6-19/h3-4,7-8,16,19H,5-6H2,1-2H3,(H2,15,17,20,22) |
| InChIKey | CKACHSURPSREIR-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|