C18H17ClN4O8 — CID 42970020
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)-5-nitrobenzoate (PubChem CID 42970020) has the molecular formula C18H17ClN4O8 and a molecular weight of 452.81 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)-5-nitrobenzoate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 42970020 |
| Molecular Formula | C18H17ClN4O8 |
| Molecular Weight | 452.81 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
| SMILES | CC(OC(=O)c1cc([N+](=O)[O-])ccc1NCCO)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C18H17ClN4O8/c1-10(17(25)21-16-5-3-12(23(29)30)9-14(16)19)31-18(26)13-8-11(22(27)28)2-4-15(13)20-6-7-24/h2-5,8-10,20,24H,6-7H2,1H3,(H,21,25) |
| InChIKey | XAZLJRFMIKGZLW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 173.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.81 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|