C19H19ClN2O8 — CID 42963237
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2,3,4-trimethoxybenzoate (PubChem CID 42963237) has the molecular formula C19H19ClN2O8 and a molecular weight of 438.82 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2,3,4-trimethoxybenzoate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 42963237 |
| Molecular Formula | C19H19ClN2O8 |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(C)C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)c(OC)c1OC |
| InChI | InChI=1S/C19H19ClN2O8/c1-10(18(23)21-14-7-5-11(22(25)26)9-13(14)20)30-19(24)12-6-8-15(27-2)17(29-4)16(12)28-3/h5-10H,1-4H3,(H,21,23) |
| InChIKey | CAVQKBMURCKXEL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|