C20H22N2O9 — CID 92510401
[(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2,3,4-trimethoxybenzoate (PubChem CID 92510401) has the molecular formula C20H22N2O9 and a molecular weight of 434.40 g/mol. Its IUPAC name is [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2,3,4-trimethoxybenzoate.
| Compound Name | [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 92510401 |
| Molecular Formula | C20H22N2O9 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)OC(=O)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C20H22N2O9/c1-11(19(23)21-14-10-12(22(25)26)6-8-15(14)27-2)31-20(24)13-7-9-16(28-3)18(30-5)17(13)29-4/h6-11H,1-5H3,(H,21,23)/t11-/m1/s1 |
| InChIKey | QIULCNHNCOSDCO-LLVKDONJSA-N |
| XLogP | 2.81 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|