C19H20N2O6S — CID 8658427
[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate (PubChem CID 8658427) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate.
| Compound Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate |
|---|---|
| PubChem CID | 8658427 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate |
| SMILES | CCSc1ccccc1C(=O)O[C@@H](C)C(=O)Nc1cc([N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C19H20N2O6S/c1-4-28-17-8-6-5-7-14(17)19(23)27-12(2)18(22)20-15-11-13(21(24)25)9-10-16(15)26-3/h5-12H,4H2,1-3H3,(H,20,22)/t12-/m0/s1 |
| InChIKey | HRLSHMVRJDUBQZ-LBPRGKRZSA-N |
| XLogP | 3.90 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|