C17H15BrN2O6 — CID 2495314
[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 3-bromobenzoate (PubChem CID 2495314) has the molecular formula C17H15BrN2O6 and a molecular weight of 423.22 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 3-bromobenzoate.
| Compound Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 3-bromobenzoate |
|---|---|
| PubChem CID | 2495314 |
| Molecular Formula | C17H15BrN2O6 |
| Molecular Weight | 423.22 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 3-bromobenzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)OC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H15BrN2O6/c1-10(26-17(22)11-4-3-5-12(18)8-11)16(21)19-14-9-13(20(23)24)6-7-15(14)25-2/h3-10H,1-2H3,(H,19,21)/t10-/m0/s1 |
| InChIKey | MKJOFXSEKOSMCJ-JTQLQIEISA-N |
| XLogP | 3.55 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|