C19H20N2O8 — CID 7995141
[(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 3,4-dimethoxybenzoate (PubChem CID 7995141) has the molecular formula C19H20N2O8 and a molecular weight of 404.38 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 3,4-dimethoxybenzoate.
| Compound Name | [(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 7995141 |
| Molecular Formula | C19H20N2O8 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 3,4-dimethoxybenzoate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@H](C)OC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H20N2O8/c1-11(29-19(23)12-5-8-15(26-2)17(9-12)28-4)18(22)20-14-7-6-13(21(24)25)10-16(14)27-3/h5-11H,1-4H3,(H,20,22)/t11-/m0/s1 |
| InChIKey | UUPGHGCFMDDBKO-NSHDSACASA-N |
| XLogP | 2.80 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|