C16H14ClN3O6 — CID 8017654
[(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate (PubChem CID 8017654) has the molecular formula C16H14ClN3O6 and a molecular weight of 379.76 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate.
| Compound Name | [(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8017654 |
| Molecular Formula | C16H14ClN3O6 |
| Molecular Weight | 379.76 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | [(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@H](C)OC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H14ClN3O6/c1-9(26-16(22)10-3-6-14(17)18-8-10)15(21)19-12-5-4-11(20(23)24)7-13(12)25-2/h3-9H,1-2H3,(H,19,21)/t9-/m0/s1 |
| InChIKey | YAQIAJGIPOLXSL-VIFPVBQESA-N |
| XLogP | 2.84 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.76 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|