C24H19ClN2O7 — CID 40786634
[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-(4-chlorobenzoyl)benzoate (PubChem CID 40786634) has the molecular formula C24H19ClN2O7 and a molecular weight of 482.88 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-(4-chlorobenzoyl)benzoate.
| Compound Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-(4-chlorobenzoyl)benzoate |
|---|---|
| PubChem CID | 40786634 |
| Molecular Formula | C24H19ClN2O7 |
| Molecular Weight | 482.88 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-(4-chlorobenzoyl)benzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)OC(=O)c1ccccc1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19ClN2O7/c1-14(23(29)26-20-13-17(27(31)32)11-12-21(20)33-2)34-24(30)19-6-4-3-5-18(19)22(28)15-7-9-16(25)10-8-15/h3-14H,1-2H3,(H,26,29)/t14-/m0/s1 |
| InChIKey | OGEGNEBPWJKGOI-AWEZNQCLSA-N |
| XLogP | 4.67 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.88 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|