C18H16Cl2N2O7 — CID 4572506
[1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 4572506) has the molecular formula C18H16Cl2N2O7 and a molecular weight of 443.24 g/mol. Its IUPAC name is [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 4572506 |
| Molecular Formula | C18H16Cl2N2O7 |
| Molecular Weight | 443.24 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OC(C)C(=O)Nc2ccc(Cl)cc2Cl)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H16Cl2N2O7/c1-9(17(23)21-13-5-4-10(19)6-12(13)20)29-18(24)11-7-15(27-2)16(28-3)8-14(11)22(25)26/h4-9H,1-3H3,(H,21,23) |
| InChIKey | SEADQVNRDTZPIB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|