C19H16ClF3N2O7 — CID 2457463
[(2S)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 2457463) has the molecular formula C19H16ClF3N2O7 and a molecular weight of 476.79 g/mol. Its IUPAC name is [(2S)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [(2S)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 2457463 |
| Molecular Formula | C19H16ClF3N2O7 |
| Molecular Weight | 476.79 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | [(2S)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)O[C@@H](C)C(=O)Nc2cc(C(F)(F)F)ccc2Cl)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H16ClF3N2O7/c1-9(17(26)24-13-6-10(19(21,22)23)4-5-12(13)20)32-18(27)11-7-15(30-2)16(31-3)8-14(11)25(28)29/h4-9H,1-3H3,(H,24,26)/t9-/m0/s1 |
| InChIKey | PLTBRICNMWHWSS-VIFPVBQESA-N |
| XLogP | 4.47 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.79 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|