C22H21ClF3NO6 — CID 6000257
[1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 6000257) has the molecular formula C22H21ClF3NO6 and a molecular weight of 487.86 g/mol. Its IUPAC name is [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6000257 |
| Molecular Formula | C22H21ClF3NO6 |
| Molecular Weight | 487.86 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OC(C)C(=O)Nc2cc(C(F)(F)F)ccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C22H21ClF3NO6/c1-12(21(29)27-16-11-14(22(24,25)26)6-7-15(16)23)33-19(28)8-5-13-9-17(30-2)20(32-4)18(10-13)31-3/h5-12H,1-4H3,(H,27,29)/b8-5+ |
| InChIKey | KCNKLPRXNHBYGF-VMPITWQZSA-N |
| XLogP | 4.97 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.86 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|