C19H15ClF3NO3 — CID 8935205
[(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 8935205) has the molecular formula C19H15ClF3NO3 and a molecular weight of 397.78 g/mol. Its IUPAC name is [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8935205 |
| Molecular Formula | C19H15ClF3NO3 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc(C(F)(F)F)cc1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H15ClF3NO3/c1-12(18(26)24-16-5-3-2-4-15(16)20)27-17(25)11-8-13-6-9-14(10-7-13)19(21,22)23/h2-12H,1H3,(H,24,26)/b11-8+/t12-/m0/s1 |
| InChIKey | VIENXGUKUQXDIL-OBIHZWKSSA-N |
| XLogP | 4.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|