C20H15F3N2O3 — CID 7355507
[(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 7355507) has the molecular formula C20H15F3N2O3 and a molecular weight of 388.35 g/mol. Its IUPAC name is [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7355507 |
| Molecular Formula | C20H15F3N2O3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc(C(F)(F)F)cc1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C20H15F3N2O3/c1-13(19(27)25-17-4-2-3-15(11-17)12-24)28-18(26)10-7-14-5-8-16(9-6-14)20(21,22)23/h2-11,13H,1H3,(H,25,27)/b10-7+/t13-/m0/s1 |
| InChIKey | PACPHXDKXPVVAN-RSPDNQDQSA-N |
| XLogP | 4.16 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|