C24H20N2O4 — CID 8517458
[(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate (PubChem CID 8517458) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate.
| Compound Name | [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8517458 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(6-methoxynaphthalen-2-yl)prop-2-enoate |
| SMILES | COc1ccc2cc(/C=C/C(=O)O[C@H](C)C(=O)Nc3cccc(C#N)c3)ccc2c1 |
| InChI | InChI=1S/C24H20N2O4/c1-16(24(28)26-21-5-3-4-18(13-21)15-25)30-23(27)11-7-17-6-8-20-14-22(29-2)10-9-19(20)12-17/h3-14,16H,1-2H3,(H,26,28)/b11-7+/t16-/m1/s1 |
| InChIKey | VCOMMTAMLAFVSM-AYAUWGRQSA-N |
| XLogP | 4.30 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|