C22H20N2O5 — CID 7724391
[(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoate (PubChem CID 7724391) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7724391 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc2c(c1)OCCCO2)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C22H20N2O5/c1-15(22(26)24-18-5-2-4-17(12-18)14-23)29-21(25)9-7-16-6-8-19-20(13-16)28-11-3-10-27-19/h2,4-9,12-13,15H,3,10-11H2,1H3,(H,24,26)/b9-7+/t15-/m0/s1 |
| InChIKey | KQQNZJOYGNMQTP-HEWZJLJBSA-N |
| XLogP | 3.30 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|