C19H15F3N2O5 — CID 7852764
[(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 7852764) has the molecular formula C19H15F3N2O5 and a molecular weight of 408.33 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7852764 |
| Molecular Formula | C19H15F3N2O5 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc([N+](=O)[O-])cc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F3N2O5/c1-12(18(26)23-15-4-2-3-14(11-15)19(20,21)22)29-17(25)10-7-13-5-8-16(9-6-13)24(27)28/h2-12H,1H3,(H,23,26)/b10-7+/t12-/m0/s1 |
| InChIKey | XDFSMUDCUWZMOV-PMDBQALLSA-N |
| XLogP | 4.20 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|