C24H21N3O6S — CID 55317776
[1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 55317776) has the molecular formula C24H21N3O6S and a molecular weight of 479.51 g/mol. Its IUPAC name is [1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | [1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55317776 |
| Molecular Formula | C24H21N3O6S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1ccc(S(=O)(=O)NCc2ccco2)cc1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C24H21N3O6S/c1-17(24(29)27-20-5-2-4-19(14-20)15-25)33-23(28)12-9-18-7-10-22(11-8-18)34(30,31)26-16-21-6-3-13-32-21/h2-14,17,26H,16H2,1H3,(H,27,29)/b12-9+ |
| InChIKey | FIYPWMABEBFAQR-FMIVXFBMSA-N |
| XLogP | 3.21 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|