C19H18ClNO3 — CID 5155564
[1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl] 3-phenylprop-2-enoate (PubChem CID 5155564) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is [1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl] 3-phenylprop-2-enoate.
| Compound Name | [1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 5155564 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | [1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl] 3-phenylprop-2-enoate |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(C)OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C19H18ClNO3/c1-13-16(20)9-6-10-17(13)21-19(23)14(2)24-18(22)12-11-15-7-4-3-5-8-15/h3-12,14H,1-2H3,(H,21,23) |
| InChIKey | OCPLDIXNANSLAI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|