C19H17ClN2O5 — CID 7709666
[(2S)-1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 7709666) has the molecular formula C19H17ClN2O5 and a molecular weight of 388.81 g/mol. Its IUPAC name is [(2S)-1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7709666 |
| Molecular Formula | C19H17ClN2O5 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [(2S)-1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | Cc1c(Cl)cccc1NC(=O)[C@H](C)OC(=O)/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17ClN2O5/c1-12-16(20)7-4-8-17(12)21-19(24)13(2)27-18(23)10-9-14-5-3-6-15(11-14)22(25)26/h3-11,13H,1-2H3,(H,21,24)/b10-9+/t13-/m0/s1 |
| InChIKey | SEKZNSDQSUYXIC-LXKVQUBZSA-N |
| XLogP | 4.14 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|