C24H21NO3 — CID 7852989
[(2R)-1-oxo-1-(2-phenylanilino)propan-2-yl] (E)-3-phenylprop-2-enoate (PubChem CID 7852989) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2-phenylanilino)propan-2-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R)-1-oxo-1-(2-phenylanilino)propan-2-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7852989 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [(2R)-1-oxo-1-(2-phenylanilino)propan-2-yl] (E)-3-phenylprop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccccc1)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H21NO3/c1-18(28-23(26)17-16-19-10-4-2-5-11-19)24(27)25-22-15-9-8-14-21(22)20-12-6-3-7-13-20/h2-18H,1H3,(H,25,27)/b17-16+/t18-/m1/s1 |
| InChIKey | SXRCSRAYMZXHSP-IECKCJDVSA-N |
| XLogP | 4.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|