C26H22N2O4 — CID 42979297
[1-oxo-1-(2-phenylanilino)propan-2-yl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate (PubChem CID 42979297) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is [1-oxo-1-(2-phenylanilino)propan-2-yl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate.
| Compound Name | [1-oxo-1-(2-phenylanilino)propan-2-yl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 42979297 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [1-oxo-1-(2-phenylanilino)propan-2-yl] (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1ccc(OCC#N)cc1)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C26H22N2O4/c1-19(32-25(29)16-13-20-11-14-22(15-12-20)31-18-17-27)26(30)28-24-10-6-5-9-23(24)21-7-3-2-4-8-21/h2-16,19H,18H2,1H3,(H,28,30)/b16-13+ |
| InChIKey | VQESKTFQRLHWOA-DTQAZKPQSA-N |
| XLogP | 4.84 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|