C21H22FNO6 — CID 8605242
[(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 8605242) has the molecular formula C21H22FNO6 and a molecular weight of 403.41 g/mol. Its IUPAC name is [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8605242 |
| Molecular Formula | C21H22FNO6 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H](C)C(=O)Nc2ccccc2F)cc(OC)c1OC |
| InChI | InChI=1S/C21H22FNO6/c1-13(21(25)23-16-8-6-5-7-15(16)22)29-19(24)10-9-14-11-17(26-2)20(28-4)18(12-14)27-3/h5-13H,1-4H3,(H,23,25)/b10-9+/t13-/m0/s1 |
| InChIKey | RISQVAYWBRVYQU-LXKVQUBZSA-N |
| XLogP | 3.44 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|