C19H21FN2O5 — CID 7919078
(2R)-N-(2-fluorophenyl)-2-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]oxypropanamide (PubChem CID 7919078) has the molecular formula C19H21FN2O5 and a molecular weight of 376.38 g/mol. Its IUPAC name is (2R)-N-(2-fluorophenyl)-2-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]oxypropanamide.
| Compound Name | (2R)-N-(2-fluorophenyl)-2-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]oxypropanamide |
|---|---|
| PubChem CID | 7919078 |
| Molecular Formula | C19H21FN2O5 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (2R)-N-(2-fluorophenyl)-2-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]oxypropanamide |
| SMILES | COc1cc(/C=N\O[C@H](C)C(=O)Nc2ccccc2F)cc(OC)c1OC |
| InChI | InChI=1S/C19H21FN2O5/c1-12(19(23)22-15-8-6-5-7-14(15)20)27-21-11-13-9-16(24-2)18(26-4)17(10-13)25-3/h5-12H,1-4H3,(H,22,23)/b21-11-/t12-/m1/s1 |
| InChIKey | XNSJXFZDEOEBDS-UORWWSPDSA-N |
| XLogP | 3.23 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|