C19H20Cl2N2O4 — CID 24511825
2-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N-[(2-chlorophenyl)methyl]propanamide (PubChem CID 24511825) has the molecular formula C19H20Cl2N2O4 and a molecular weight of 411.29 g/mol. Its IUPAC name is 2-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N-[(2-chlorophenyl)methyl]propanamide.
| Compound Name | 2-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N-[(2-chlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 24511825 |
| Molecular Formula | C19H20Cl2N2O4 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 2-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N-[(2-chlorophenyl)methyl]propanamide |
| SMILES | COc1cc(/C=N/OC(C)C(=O)NCc2ccccc2Cl)cc(Cl)c1OC |
| InChI | InChI=1S/C19H20Cl2N2O4/c1-12(19(24)22-11-14-6-4-5-7-15(14)20)27-23-10-13-8-16(21)18(26-3)17(9-13)25-2/h4-10,12H,11H2,1-3H3,(H,22,24)/b23-10+ |
| InChIKey | PZLWHTKQZCRKQY-AUEPDCJTSA-N |
| XLogP | 4.07 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|