C20H22ClNO5 — CID 46590061
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[(2,4-dimethoxyphenyl)methyl]prop-2-enamide (PubChem CID 46590061) has the molecular formula C20H22ClNO5 and a molecular weight of 391.85 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[(2,4-dimethoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[(2,4-dimethoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 46590061 |
| Molecular Formula | C20H22ClNO5 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[(2,4-dimethoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(CNC(=O)/C=C/c2cc(Cl)c(OC)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C20H22ClNO5/c1-24-15-7-6-14(17(11-15)25-2)12-22-19(23)8-5-13-9-16(21)20(27-4)18(10-13)26-3/h5-11H,12H2,1-4H3,(H,22,23)/b8-5+ |
| InChIKey | XYCCYZPDPVTPJS-VMPITWQZSA-N |
| XLogP | 3.70 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|