C21H24ClNO4 — CID 98812251
(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[(3-ethoxyphenyl)methyl]prop-2-enamide (PubChem CID 98812251) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[(3-ethoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[(3-ethoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 98812251 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[(3-ethoxyphenyl)methyl]prop-2-enamide |
| SMILES | CCOc1cccc(CNC(=O)/C=C/c2cc(Cl)c(OC)c(OCC)c2)c1 |
| InChI | InChI=1S/C21H24ClNO4/c1-4-26-17-8-6-7-16(11-17)14-23-20(24)10-9-15-12-18(22)21(25-3)19(13-15)27-5-2/h6-13H,4-5,14H2,1-3H3,(H,23,24)/b10-9+ |
| InChIKey | AZBUIMDFWSVLNW-MDZDMXLPSA-N |
| XLogP | 4.48 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|