C21H25ClN2O5S — CID 34557638
(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 34557638) has the molecular formula C21H25ClN2O5S and a molecular weight of 452.96 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 34557638 |
| Molecular Formula | C21H25ClN2O5S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)NCc2ccc(CS(=O)(=O)NC)cc2)cc(Cl)c1OC |
| InChI | InChI=1S/C21H25ClN2O5S/c1-4-29-19-12-17(11-18(22)21(19)28-3)9-10-20(25)24-13-15-5-7-16(8-6-15)14-30(26,27)23-2/h5-12,23H,4,13-14H2,1-3H3,(H,24,25)/b10-9+ |
| InChIKey | IOWVQRKLOFPANG-MDZDMXLPSA-N |
| XLogP | 3.13 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|