C18H18Cl2N2O3S — CID 38123668
(E)-3-(2,6-dichlorophenyl)-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 38123668) has the molecular formula C18H18Cl2N2O3S and a molecular weight of 413.33 g/mol. Its IUPAC name is (E)-3-(2,6-dichlorophenyl)-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,6-dichlorophenyl)-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 38123668 |
| Molecular Formula | C18H18Cl2N2O3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | (E)-3-(2,6-dichlorophenyl)-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | CNS(=O)(=O)Cc1ccc(CNC(=O)/C=C/c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O3S/c1-21-26(24,25)12-14-7-5-13(6-8-14)11-22-18(23)10-9-15-16(19)3-2-4-17(15)20/h2-10,21H,11-12H2,1H3,(H,22,23)/b10-9+ |
| InChIKey | KPJYENUEXCUKDC-MDZDMXLPSA-N |
| XLogP | 3.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|