C20H18Cl2N2O2 — CID 8589365
(E)-3-(2,6-dichlorophenyl)-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]prop-2-enamide (PubChem CID 8589365) has the molecular formula C20H18Cl2N2O2 and a molecular weight of 389.28 g/mol. Its IUPAC name is (E)-3-(2,6-dichlorophenyl)-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,6-dichlorophenyl)-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 8589365 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | (E)-3-(2,6-dichlorophenyl)-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)cccc1Cl)NCc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C20H18Cl2N2O2/c21-17-3-1-4-18(22)16(17)10-11-19(25)23-13-14-6-8-15(9-7-14)24-12-2-5-20(24)26/h1,3-4,6-11H,2,5,12-13H2,(H,23,25)/b11-10+ |
| InChIKey | RPETUUOYSWLUHN-ZHACJKMWSA-N |
| XLogP | 4.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|