C24H25N3O3 — CID 39002604
(E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]prop-2-enamide (PubChem CID 39002604) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is (E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 39002604 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(N2CCCC2=O)cc1)NCc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C24H25N3O3/c28-22(13-10-18-8-11-20(12-9-18)26-14-2-6-23(26)29)25-17-19-4-1-5-21(16-19)27-15-3-7-24(27)30/h1,4-5,8-13,16H,2-3,6-7,14-15,17H2,(H,25,28)/b13-10+ |
| InChIKey | XXMDQWWTERKKQJ-JLHYYAGUSA-N |
| XLogP | 3.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|