C22H23N3O3 — CID 39003599
4-(2-oxopyrrolidin-1-yl)-N-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]benzamide (PubChem CID 39003599) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-(2-oxopyrrolidin-1-yl)-N-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]benzamide.
| Compound Name | 4-(2-oxopyrrolidin-1-yl)-N-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 39003599 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-(2-oxopyrrolidin-1-yl)-N-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(N2CCCC2=O)c1)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C22H23N3O3/c26-20-6-2-12-24(20)18-10-8-17(9-11-18)22(28)23-15-16-4-1-5-19(14-16)25-13-3-7-21(25)27/h1,4-5,8-11,14H,2-3,6-7,12-13,15H2,(H,23,28) |
| InChIKey | PIVCLVGAEYWWTN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |