C27H28N4O3 — CID 55957158
N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-4-(2-oxopiperidin-1-yl)benzamide (PubChem CID 55957158) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-4-(2-oxopiperidin-1-yl)benzamide.
| Compound Name | N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-4-(2-oxopiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 55957158 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-4-(2-oxopiperidin-1-yl)benzamide |
| SMILES | Cc1cccc(NC(=O)Nc2cccc(CNC(=O)c3ccc(N4CCCCC4=O)cc3)c2)c1 |
| InChI | InChI=1S/C27H28N4O3/c1-19-6-4-8-22(16-19)29-27(34)30-23-9-5-7-20(17-23)18-28-26(33)21-11-13-24(14-12-21)31-15-3-2-10-25(31)32/h4-9,11-14,16-17H,2-3,10,15,18H2,1H3,(H,28,33)(H2,29,30,34) |
| InChIKey | NZILWBFLKZMAJP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |