C20H20N2O3 — CID 25490304
(E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-phenylmethoxyprop-2-enamide (PubChem CID 25490304) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-phenylmethoxyprop-2-enamide.
| Compound Name | (E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-phenylmethoxyprop-2-enamide |
|---|---|
| PubChem CID | 25490304 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-phenylmethoxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(N2CCCC2=O)cc1)NOCc1ccccc1 |
| InChI | InChI=1S/C20H20N2O3/c23-19(21-25-15-17-5-2-1-3-6-17)13-10-16-8-11-18(12-9-16)22-14-4-7-20(22)24/h1-3,5-6,8-13H,4,7,14-15H2,(H,21,23)/b13-10+ |
| InChIKey | LAIJLAORJNTTRF-JLHYYAGUSA-N |
| XLogP | 3.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|