C22H22N2O4 — CID 17438984
methyl 4-[[[(E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoyl]amino]methyl]benzoate (PubChem CID 17438984) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is methyl 4-[[[(E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 17438984 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | methyl 4-[[[(E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)/C=C/c2ccc(N3CCCC3=O)cc2)cc1 |
| InChI | InChI=1S/C22H22N2O4/c1-28-22(27)18-9-4-17(5-10-18)15-23-20(25)13-8-16-6-11-19(12-7-16)24-14-2-3-21(24)26/h4-13H,2-3,14-15H2,1H3,(H,23,25)/b13-8+ |
| InChIKey | JAWXQDIBHBXMHP-MDWZMJQESA-N |
| XLogP | 2.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|