C23H29IN4O3 — CID 111162475
methyl 4-[[[N-ethyl-N'-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]benzoate;hydroiodide (PubChem CID 111162475) has the molecular formula C23H29IN4O3 and a molecular weight of 536.41 g/mol. Its IUPAC name is methyl 4-[[[N-ethyl-N'-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]benzoate;hydroiodide.
| Compound Name | methyl 4-[[[N-ethyl-N'-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111162475 |
| Molecular Formula | C23H29IN4O3 |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | methyl 4-[[[N-ethyl-N'-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]benzoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCCC2=O)cc1)NCc1ccc(C(=O)OC)cc1.I |
| InChI | InChI=1S/C23H28N4O3.HI/c1-3-24-23(25-15-17-6-10-19(11-7-17)22(29)30-2)26-16-18-8-12-20(13-9-18)27-14-4-5-21(27)28;/h6-13H,3-5,14-16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | XPIDKLPTOYGDOH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|