C24H32IN5O3 — CID 111414011
2-[[N-ethyl-N'-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide (PubChem CID 111414011) has the molecular formula C24H32IN5O3 and a molecular weight of 565.46 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide.
| Compound Name | 2-[[N-ethyl-N'-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111414011 |
| Molecular Formula | C24H32IN5O3 |
| Molecular Weight | 565.46 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | 2-[[N-ethyl-N'-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCCC2=O)cc1)NCC(=O)NCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C24H31N5O3.HI/c1-3-25-24(28-17-22(30)26-15-19-8-12-21(32-2)13-9-19)27-16-18-6-10-20(11-7-18)29-14-4-5-23(29)31;/h6-13H,3-5,14-17H2,1-2H3,(H,26,30)(H2,25,27,28);1H |
| InChIKey | ISXKVBSUBBQSAS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|