C24H32N4O4 — CID 111757368
1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine (PubChem CID 111757368) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111757368 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 1-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCCC2=O)cc1)NCC(O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C24H32N4O4/c1-4-25-24(27-16-22(29)18-12-20(31-2)14-21(13-18)32-3)26-15-17-7-9-19(10-8-17)28-11-5-6-23(28)30/h7-10,12-14,22,29H,4-6,11,15-16H2,1-3H3,(H2,25,26,27) |
| InChIKey | JYUYTUGANRFAGJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|