C23H22N2O4 — CID 55514251
methyl 1-[(E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoyl]-2,3-dihydroindole-5-carboxylate (PubChem CID 55514251) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is methyl 1-[(E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoyl]-2,3-dihydroindole-5-carboxylate.
| Compound Name | methyl 1-[(E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoyl]-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 55514251 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | methyl 1-[(E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoyl]-2,3-dihydroindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCN2C(=O)/C=C/c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C23H22N2O4/c1-29-23(28)18-7-10-20-17(15-18)12-14-25(20)22(27)11-6-16-4-8-19(9-5-16)24-13-2-3-21(24)26/h4-11,15H,2-3,12-14H2,1H3/b11-6+ |
| InChIKey | DJMUYVJFYUWQNX-IZZDOVSWSA-N |
| XLogP | 3.20 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|