C26H29N3O4S — CID 55491590
1-[4-[(E)-3-oxo-3-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-1-enyl]phenyl]pyrrolidin-2-one (PubChem CID 55491590) has the molecular formula C26H29N3O4S and a molecular weight of 479.60 g/mol. Its IUPAC name is 1-[4-[(E)-3-oxo-3-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-1-enyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[(E)-3-oxo-3-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-1-enyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 55491590 |
| Molecular Formula | C26H29N3O4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 1-[4-[(E)-3-oxo-3-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-1-enyl]phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1ccc(/C=C/C(=O)N2CCc3cc(S(=O)(=O)N4CCCCC4)ccc32)cc1 |
| InChI | InChI=1S/C26H29N3O4S/c30-25-5-4-17-28(25)22-9-6-20(7-10-22)8-13-26(31)29-18-14-21-19-23(11-12-24(21)29)34(32,33)27-15-2-1-3-16-27/h6-13,19H,1-5,14-18H2/b13-8+ |
| InChIKey | BBFRDBLDAZNOBS-MDWZMJQESA-N |
| XLogP | 3.59 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|