C23H26N2O4S — CID 26466074
(E)-3-(3-methoxyphenyl)-1-(6-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)prop-2-en-1-one (PubChem CID 26466074) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is (E)-3-(3-methoxyphenyl)-1-(6-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-methoxyphenyl)-1-(6-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 26466074 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | (E)-3-(3-methoxyphenyl)-1-(6-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)prop-2-en-1-one |
| SMILES | COc1cccc(/C=C/C(=O)N2CCCc3cc(S(=O)(=O)N4CCCC4)ccc32)c1 |
| InChI | InChI=1S/C23H26N2O4S/c1-29-20-8-4-6-18(16-20)9-12-23(26)25-15-5-7-19-17-21(10-11-22(19)25)30(27,28)24-13-2-3-14-24/h4,6,8-12,16-17H,2-3,5,7,13-15H2,1H3/b12-9+ |
| InChIKey | FKGMMJOSUVNVCB-FMIVXFBMSA-N |
| XLogP | 3.47 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|