C22H23FN2O3S — CID 18206902
(E)-3-(2-fluorophenyl)-1-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-2-en-1-one (PubChem CID 18206902) has the molecular formula C22H23FN2O3S and a molecular weight of 414.50 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-1-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-fluorophenyl)-1-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 18206902 |
| Molecular Formula | C22H23FN2O3S |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-1-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1F)N1CCc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C22H23FN2O3S/c23-20-7-3-2-6-17(20)8-11-22(26)25-15-12-18-16-19(9-10-21(18)25)29(27,28)24-13-4-1-5-14-24/h2-3,6-11,16H,1,4-5,12-15H2/b11-8+ |
| InChIKey | YSHXYVPQDLUDFN-DHZHZOJOSA-N |
| XLogP | 3.60 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|