C23H21NO3S — CID 55661641
(E)-1-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-3-naphthalen-1-ylprop-2-en-1-one (PubChem CID 55661641) has the molecular formula C23H21NO3S and a molecular weight of 391.49 g/mol. Its IUPAC name is (E)-1-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-3-naphthalen-1-ylprop-2-en-1-one.
| Compound Name | (E)-1-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-3-naphthalen-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 55661641 |
| Molecular Formula | C23H21NO3S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (E)-1-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-3-naphthalen-1-ylprop-2-en-1-one |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCCN2C(=O)/C=C/c1cccc2ccccc12 |
| InChI | InChI=1S/C23H21NO3S/c1-28(26,27)20-12-13-22-19(16-20)9-5-15-24(22)23(25)14-11-18-8-4-7-17-6-2-3-10-21(17)18/h2-4,6-8,10-14,16H,5,9,15H2,1H3/b14-11+ |
| InChIKey | CIEHHQQJPYRTQQ-SDNWHVSQSA-N |
| XLogP | 4.24 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|