C21H21NO2S — CID 71844826
6-methylsulfonyl-1-(naphthalen-1-ylmethyl)-3,4-dihydro-2H-quinoline (PubChem CID 71844826) has the molecular formula C21H21NO2S and a molecular weight of 351.47 g/mol. Its IUPAC name is 6-methylsulfonyl-1-(naphthalen-1-ylmethyl)-3,4-dihydro-2H-quinoline.
| Compound Name | 6-methylsulfonyl-1-(naphthalen-1-ylmethyl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 71844826 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 6-methylsulfonyl-1-(naphthalen-1-ylmethyl)-3,4-dihydro-2H-quinoline |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCCN2Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H21NO2S/c1-25(23,24)19-11-12-21-17(14-19)9-5-13-22(21)15-18-8-4-7-16-6-2-3-10-20(16)18/h2-4,6-8,10-12,14H,5,9,13,15H2,1H3 |
| InChIKey | SNCSXZQMOKLXBN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |